NU2058, 99%, 99%
cas: 161058-83-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
NU2058, 99%, 99% (CAS 161058-83-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch112VLL-1mg |
| cas | 161058-83-9 |
| opakowanie | 1mg |
| dostępność | 1.25g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 122,00 Pln | |
| Chemat | 5mg | 131,60 Pln | |
| Chemat | 10mg | 170,00 Pln | |
| Chemat | 25mg | 222,80 Pln | |
| Chemat | 50mg | 285,20 Pln | |
| Chemat | 100mg | 333,20 Pln | |
| Chemat | 250mg | 443,60 Pln |
właściwości
| czystość | 99% |
|---|---|
| czas dostawy | 3 tygodnie |
6-(cyclohexylmethoxy)-7H-purin-2-amine (CAS 161058-83-9) to związek chemiczny o wzorze sumarycznym C12H17N5O i masie molowej 247.30 g/mol. Nazwa systematyczna IUPAC: 6-(cyclohexylmethoxy)-7H-purin-2-amine. InChIKey: MWGXGTJJAOZBNW-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H17N5O |
|---|---|
| Masa molowa | 247.30 g/mol |
| Nazwa IUPAC | 6-(cyclohexylmethoxy)-7H-purin-2-amine |
| InChIKey | MWGXGTJJAOZBNW-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)COC2=NC(=NC3=C2NC=N3)N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
nu2058, O(6)-cyclohexylmethylguanine, 6-(cyclohexylmethoxy)-9H-purin-2-amine, 9H-Purin-2-amine, 6-(cyclohexylmethoxy)-, 2-amino-6-[(cyclohexylmethyl)oxy]purine, 6-(cyclohexylmethoxy)-7H-purin-2-amine, 1H-Purin-2-amine, 6-(cyclohexylmethoxy)-, 2-amino-6-cyclohexylmethoxypurine, 1e1v, O-Cyclohexylmethylguanine