Naringenin trimethyl ether
cas: 38302-15-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Naringenin trimethyl ether (CAS 38302-15-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg. Oferty producentów: TargetMol, Biosynth.
| producent | TargetMol |
|---|---|
| nr katalogowy | T2S2169-1mg |
| cas | 38302-15-7 |
| opakowanie | 1mg |
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 1mg | 392,86 Pln | |
| TargetMol | 2mg | 518,63 Pln | |
| TargetMol | 5mg | 817,70 Pln | |
| TargetMol | 10mg | 1282,22 Pln | |
| TargetMol | 25mg | 2012,84 Pln | |
| TargetMol | 50mg | 2922,89 Pln | |
| Biosynth | 5mg | cena na żądanie |
właściwości
| czystość | No data |
|---|---|
| czas dostawy | ok. 15 dni |
5,7-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one (CAS 38302-15-7) to związek chemiczny o wzorze sumarycznym C18H18O5 i masie molowej 314.3 g/mol. Nazwa systematyczna IUPAC: 5,7-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one. InChIKey: MQFSCAHSIUPLSB-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H18O5 |
|---|---|
| Masa molowa | 314.3 g/mol |
| Nazwa IUPAC | 5,7-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | MQFSCAHSIUPLSB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CC(=O)C3=C(O2)C=C(C=C3OC)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Naringenin trimethyl ether, 5,7-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one, 5,7-Dimethoxy-2-(4-methoxyphenyl)chroman-4-one, 5,7,4'-Trimethoxyflavanone, 4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dimethoxy-2-(4-methoxyphenyl)-, 4',5,7-Trimethoxyflavanone, Naringenintrimethylether, Sakuranetin dimethyl ether, Oprea1_436908, 5, 4' Trimethoxy Flavanone