cas: 131060-14-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Nb-598, 98%, 98% (CAS 131060-14-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch111VGJ-1mg |
| cas | 131060-14-5 |
| opakowanie | 1mg |
| dostępność | 0.3g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 136,40 Pln | |
| Chemat | 5mg | 290,00 Pln | |
| Chemat | 10mg | 429,20 Pln | |
| Chemat | 25mg | 798,80 Pln | |
| Chemat | 50mg | 1312,40 Pln | |
| Chemat | 100mg | 2186,00 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(E)-N-ethyl-6,6-dimethyl-N-[[3-[(4-thiophen-3-ylthiophen-2-yl)methoxy]phenyl]methyl]hept-2-en-4-yn-1-amine (CAS 131060-14-5) to związek chemiczny o wzorze sumarycznym C27H31NOS2 i masie molowej 449.7 g/mol. Nazwa systematyczna IUPAC: (E)-N-ethyl-6,6-dimethyl-N-[[3-[(4-thiophen-3-ylthiophen-2-yl)methoxy]phenyl]methyl]hept-2-en-4-yn-1-amine. InChIKey: KIRGLCXNEVICOG-SOFGYWHQSA-N.
| Wzór sumaryczny | C27H31NOS2 |
|---|---|
| Masa molowa | 449.7 g/mol |
| Nazwa IUPAC | (E)-N-ethyl-6,6-dimethyl-N-[[3-[(4-thiophen-3-ylthiophen-2-yl)methoxy]phenyl]methyl]hept-2-en-4-yn-1-amine |
| InChIKey | KIRGLCXNEVICOG-SOFGYWHQSA-N |
| SMILES | CCN(C/C=C/C#CC(C)(C)C)CC1=CC(=CC=C1)OCC2=CC(=CS2)C3=CSC=C3 |
Dane obliczone przez PubChem (NCBI)