cas: 1432061-50-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Nicardipine-d3 hydrochloride (CAS 1432061-50-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg. Oferty producentów: TargetMol.
| producent | TargetMol |
|---|---|
| nr katalogowy | T12221-1mg |
| cas | 1432061-50-1 |
| opakowanie | 1mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 1mg | 4091,76 Pln | |
| TargetMol | 5mg | 8335,13 Pln | |
| TargetMol | 10mg | 11111,12 Pln |
| czystość | No data |
|---|---|
| czas dostawy | ok. 33 dni |
5-O-[2-[benzyl(trideuteriomethyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride (CAS 1432061-50-1) to związek chemiczny o wzorze sumarycznym C26H30ClN3O6 i masie molowej 519.0 g/mol. Nazwa systematyczna IUPAC: 5-O-[2-[benzyl(trideuteriomethyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride. InChIKey: AIKVCUNQWYTVTO-FJCVKDQNSA-N.
| Wzór sumaryczny | C26H30ClN3O6 |
|---|---|
| Masa molowa | 519.0 g/mol |
| Nazwa IUPAC | 5-O-[2-[benzyl(trideuteriomethyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
| InChIKey | AIKVCUNQWYTVTO-FJCVKDQNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCOC(=O)C1=C(NC(=C(C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC)C)C)CC3=CC=CC=C3.Cl |
Dane obliczone przez PubChem (NCBI)