O,O'-Bis(2-aminoethyl)hexaethylene glycol
cas: 332941-25-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
O,O'-Bis(2-aminoethyl)hexaethylene glycol (CAS 332941-25-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg, 250mg, 500mg, 1000mg. Oferty producentów: Biosynth.
| producent | Biosynth |
|---|---|
| nr katalogowy | FB18661-50mg |
| cas | 332941-25-0 |
| opakowanie | 50mg |
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Biosynth | 50mg | cena na żądanie | |
| Biosynth | 100mg | cena na żądanie | |
| Biosynth | 250mg | cena na żądanie | |
| Biosynth | 500mg | cena na żądanie | |
| Biosynth | 1000mg | cena na żądanie |
właściwości
| kategoria | Research Chemicals |
|---|---|
| czystość | No data |
| czas dostawy | 1-2 tygodnie |
2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 332941-25-0) to związek chemiczny o wzorze sumarycznym C16H36N2O7 i masie molowej 368.47 g/mol. Nazwa systematyczna IUPAC: 2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: MWECBIRKDAZDRL-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H36N2O7 |
|---|---|
| Masa molowa | 368.47 g/mol |
| Nazwa IUPAC | 2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | MWECBIRKDAZDRL-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCN)N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3,6,9,12,15,18,21-Heptaoxatricosane-1,23-diamine, Amino-PEG7-Amine, alpha,omega-Bis-amino octa(ethylene glycol), O,O inverted exclamation marka-Bis(2-aMinoethyl)polyethylene Glycol, O,O?-Bis(2-aminoethyl)hexaethylene Glycol, O,O'-Bis(2-aminoethyl)hexaethylene Glycol, O,O inverted exclamation marka-Bis(2-aminoethyl)hexaethylene Glycol, orb1909523, ?,?-BIs(amino)-octaethylene glycol, O,O 2-Bis(2-aminoethyl)hexaethylene Glycol