cas: 5191-97-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Ornithine-α-ketoglutarate (CAS 5191-97-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 25g, 100g. Oferty producentów: TargetMol, Chemat.
| producent | TargetMol |
|---|---|
| nr katalogowy | T21024-5mg |
| cas | 5191-97-9 |
| opakowanie | 5mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 5mg | 379,44 Pln | |
| TargetMol | 10mg | 458,82 Pln | |
| TargetMol | 25mg | 624,84 Pln | |
| TargetMol | 50mg | 817,70 Pln | |
| TargetMol | 100mg | 1122,91 Pln | |
| TargetMol | 200mg | 1448,25 Pln | |
| Chemat | 25g | 170,00 Pln | |
| Chemat | 100g | 285,20 Pln | |
| Chemat | 500g | 792,00 Pln |
| czystość | No data |
|---|---|
| czas dostawy | ok. 15 dni |
(2S)-2,5-diaminopentanoic acid;2-oxopentanedioic acid (CAS 5191-97-9) to związek chemiczny o wzorze sumarycznym C10H18N2O7 i masie molowej 278.26 g/mol. Nazwa systematyczna IUPAC: (2S)-2,5-diaminopentanoic acid;2-oxopentanedioic acid. InChIKey: SLPUVFBNQHVEEU-WCCKRBBISA-N.
| Wzór sumaryczny | C10H18N2O7 |
|---|---|
| Masa molowa | 278.26 g/mol |
| Nazwa IUPAC | (2S)-2,5-diaminopentanoic acid;2-oxopentanedioic acid |
| InChIKey | SLPUVFBNQHVEEU-WCCKRBBISA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CN.C(CC(=O)O)C(=O)C(=O)O |
Dane obliczone przez PubChem (NCBI)