Oxybutynin Impurity 2（Oxybutynin EP Impurity B）
cas: 14943-53-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Oxybutynin Impurity 2（Oxybutynin EP Impurity B） (CAS 14943-53-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mg, 25mg, 50mg, 100mg, 200mg. Oferty producentów: Hubei YoungXin.
| producent | Hubei YoungXin |
|---|---|
| nr katalogowy | 12562O-10mg |
| cas | 14943-53-4 |
| opakowanie | 10mg |
| dostępność | Do potwierdzenia przez Chemat|To be confirmed by Chemat |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Hubei YoungXin | 10mg | cena na żądanie | |
| Hubei YoungXin | 25mg | cena na żądanie | |
| Hubei YoungXin | 50mg | cena na żądanie | |
| Hubei YoungXin | 100mg | cena na żądanie | |
| Hubei YoungXin | 200mg | cena na żądanie |
właściwości
| czystość | No data |
|---|---|
| czas dostawy | Do potwierdzenia przez Chemat |
4-(diethylamino)but-2-ynyl 2-hydroxy-2,2-diphenylacetate (CAS 14943-53-4) to związek chemiczny o wzorze sumarycznym C22H25NO3 i masie molowej 351.4 g/mol. Nazwa systematyczna IUPAC: 4-(diethylamino)but-2-ynyl 2-hydroxy-2,2-diphenylacetate. InChIKey: YGGLNZUXAWIXQH-UHFFFAOYSA-N.
| Wzór sumaryczny | C22H25NO3 |
|---|---|
| Masa molowa | 351.4 g/mol |
| Nazwa IUPAC | 4-(diethylamino)but-2-ynyl 2-hydroxy-2,2-diphenylacetate |
| InChIKey | YGGLNZUXAWIXQH-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC#CCOC(=O)C(C1=CC=CC=C1)(C2=CC=CC=C2)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
alpha-Descyclohexyl-alpha-phenyl Oxybutynin, 4-(diethylamino)but-2-ynyl 2-hydroxy-2,2-diphenylacetate, Oxybutynin hydrochloride impurity B [EP], .ALPHA.-DESCYCLOHEXYL-.ALPHA.-PHENYL OXYBUTYNIN, OXYBUTYNIN HYDROCHLORIDE IMPURITY B [EP IMPURITY], OXYBUTYNIN HYDROCHLORIDE IMPURITY B (EP IMPURITY), Oxybutynin chloride impurity, diphenyl analog of oxybutynin chloride-(USP), Oxybutynin chloride impurity, diphenyl analog of oxybutynin chloride-[USP], Oxybutynin hydrochloride impurity B, Oxybutynin EP Impurity B