PD-1-IN-24, 98.12%
cas: 2360909-50-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
PD-1-IN-24, 98.12% (CAS 2360909-50-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 mg, 5 mg, 10mM/1mL, 50 mg, 10 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-134886-25 mg |
| cas | 2360909-50-6 |
| opakowanie | 25 mg |
| dostępność | In stock |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 mg | 8038,02 Pln | |
| MedChemExpress | 5 mg | 2279,46 Pln | |
| MedChemExpress | 10mM/1mL | 2349,12 Pln | |
| MedChemExpress | 50 mg | 12352,30 Pln | |
| MedChemExpress | 10 mg | 3955,94 Pln | |
| MedChemExpress | 100 mg | 18830,68 Pln |
właściwości
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.12% |
(2S)-3-hydroxy-2-methyl-2-[[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methylamino]propanoic acid (CAS 2360909-50-6) to związek chemiczny o wzorze sumarycznym C27H26F3NO3 i masie molowej 469.5 g/mol. Nazwa systematyczna IUPAC: (2S)-3-hydroxy-2-methyl-2-[[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methylamino]propanoic acid. InChIKey: ITARRJJJADSSAW-JYSHFMIGSA-N.
| Wzór sumaryczny | C27H26F3NO3 |
|---|---|
| Masa molowa | 469.5 g/mol |
| Nazwa IUPAC | (2S)-3-hydroxy-2-methyl-2-[[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methylamino]propanoic acid |
| InChIKey | ITARRJJJADSSAW-JYSHFMIGSA-N |
| SMILES | CC1=C(C=CC=C1C2=CC=CC=C2)/C=C/C3=C(C=CC(=C3)CN[C@@](C)(CO)C(=O)O)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
ITARRJJJADSSAW-JYSHFMIGSA-N