cas: 1173111-67-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
PF-04929113 Mesylate (CAS 1173111-67-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch119TPB-1mg |
| cas | 1173111-67-5 |
| opakowanie | 1mg |
| dostępność | 0.5g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 520,40 Pln | |
| Chemat | 2mg | 736,40 Pln | |
| Chemat | 5mg | 1216,40 Pln | |
| Chemat | 10mg | 2070,80 Pln | |
| Chemat | 25mg | 3410,00 Pln | |
| Chemat | 50mg | 4830,80 Pln | |
| Chemat | 100mg | 6515,60 Pln | |
| Chemat | 500mg | 12942,80 Pln |
| czas dostawy | 3 tygodnie |
|---|
[4-[2-carbamoyl-5-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]anilino]cyclohexyl] 2-aminoacetate;methanesulfonic acid (CAS 1173111-67-5) to związek chemiczny o wzorze sumarycznym C26H34F3N5O7S i masie molowej 617.6 g/mol. Nazwa systematyczna IUPAC: [4-[2-carbamoyl-5-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]anilino]cyclohexyl] 2-aminoacetate;methanesulfonic acid. InChIKey: NVGFSTMGRRADRG-UHFFFAOYSA-N.
| Wzór sumaryczny | C26H34F3N5O7S |
|---|---|
| Masa molowa | 617.6 g/mol |
| Nazwa IUPAC | [4-[2-carbamoyl-5-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]anilino]cyclohexyl] 2-aminoacetate;methanesulfonic acid |
| InChIKey | NVGFSTMGRRADRG-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(=O)C1)C(=NN2C3=CC(=C(C=C3)C(=O)N)NC4CCC(CC4)OC(=O)CN)C(F)(F)F)C.CS(=O)(=O)O |
Dane obliczone przez PubChem (NCBI)