cas: 2143896-83-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
PKUMDL-LC-101-D04, 99.83% (CAS 2143896-83-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 25 mg, 1 mg, 1 g, 5 mg, 500 mg, 250 mg, 10mM/1mL. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-115627-100 mg |
| cas | 2143896-83-5 |
| opakowanie | 100 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 4773,29 Pln | |
| MedChemExpress | 25 mg | 2493,08 Pln | |
| MedChemExpress | 1 mg | 551,89 Pln | |
| MedChemExpress | 1 g | 14274,91 Pln | |
| MedChemExpress | 5 mg | 1067,38 Pln | |
| MedChemExpress | 500 mg | 10192,84 Pln | |
| MedChemExpress | 250 mg | 7123,15 Pln | |
| MedChemExpress | 10mM/1mL | 904,84 Pln | |
| MedChemExpress | 10 mg | 1722,18 Pln | |
| MedChemExpress | 50 mg | 3431,17 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.83% |
1-[4-(2-aminoethylsulfamoyl)phenyl]-3-cyclopentylthiourea;hydrochloride (CAS 2143896-83-5) to związek chemiczny o wzorze sumarycznym C14H23ClN4O2S2 i masie molowej 378.9 g/mol. Nazwa systematyczna IUPAC: 1-[4-(2-aminoethylsulfamoyl)phenyl]-3-cyclopentylthiourea;hydrochloride. InChIKey: FELDRJSFLBINQS-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H23ClN4O2S2 |
|---|---|
| Masa molowa | 378.9 g/mol |
| Nazwa IUPAC | 1-[4-(2-aminoethylsulfamoyl)phenyl]-3-cyclopentylthiourea;hydrochloride |
| InChIKey | FELDRJSFLBINQS-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC(=S)NC2=CC=C(C=C2)S(=O)(=O)NCCN.Cl |
Dane obliczone przez PubChem (NCBI)