cas: 66246-88-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Penconazole, 98.91% (CAS 66246-88-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1 g, 500 mg, 10 g, 100 mg, 10mM/1mL, 5 g, 250 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-135761-1 g |
| cas | 66246-88-6 |
| opakowanie | 1 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 1 g | 886,26 Pln | |
| MedChemExpress | 500 mg | 640,13 Pln | |
| MedChemExpress | 10 g | 1750,04 Pln | |
| MedChemExpress | 100 mg | 310,40 Pln | |
| MedChemExpress | 10mM/1mL | 384,71 Pln | |
| MedChemExpress | 5 g | 1197,41 Pln | |
| MedChemExpress | 250 mg | 463,66 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 98.91% |
1-[2-(2,4-dichlorophenyl)pentyl]-1,2,4-triazole (CAS 66246-88-6) to związek chemiczny o wzorze sumarycznym C13H15Cl2N3 i masie molowej 284.18 g/mol. Nazwa systematyczna IUPAC: 1-[2-(2,4-dichlorophenyl)pentyl]-1,2,4-triazole. InChIKey: WKBPZYKAUNRMKP-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H15Cl2N3 |
|---|---|
| Masa molowa | 284.18 g/mol |
| Nazwa IUPAC | 1-[2-(2,4-dichlorophenyl)pentyl]-1,2,4-triazole |
| InChIKey | WKBPZYKAUNRMKP-UHFFFAOYSA-N |
| SMILES | CCCC(CN1C=NC=N1)C2=C(C=C(C=C2)Cl)Cl |
Dane obliczone przez PubChem (NCBI)