Perfluorotriethylamine, 94%
cas: 359-70-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Perfluorotriethylamine, 94% (CAS 359-70-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 25g, 10g, 15g, 100g. Oferty producentów: Fluorochem, Chemat.
| producent | Fluorochem |
|---|---|
| nr katalogowy | F007170-1G |
| cas | 359-70-6 |
| opakowanie | 1g |
| dostępność | In Stock UK |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Fluorochem | 1g | 102,07 Pln | |
| Fluorochem | 5g | 174,96 Pln | |
| Fluorochem | 25g | 362,39 Pln | |
| Chemat | 5g | 117,20 Pln | |
| Chemat | 10g | 170,00 Pln | |
| Chemat | 15g | 218,00 Pln | |
| Chemat | 25g | 227,60 Pln | |
| Chemat | 100g | 741,20 Pln |
właściwości
| czystość | 94% |
|---|---|
| podwójne zastosowanie | Yes |
| waluta | EUR |
| czas dostawy | 1-2 tygodnie |
| kategoria | Odczynniki chemiczne |
1,1,2,2,2-pentafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)ethanamine (CAS 359-70-6) to związek chemiczny o wzorze sumarycznym C6F15N i masie molowej 371.05 g/mol. Nazwa systematyczna IUPAC: 1,1,2,2,2-pentafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)ethanamine. InChIKey: CBEFDCMSEZEGCX-UHFFFAOYSA-N.
| Wzór sumaryczny | C6F15N |
|---|---|
| Masa molowa | 371.05 g/mol |
| Nazwa IUPAC | 1,1,2,2,2-pentafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)ethanamine |
| InChIKey | CBEFDCMSEZEGCX-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(N(C(C(F)(F)F)(F)F)C(C(F)(F)F)(F)F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Perfluorotriethylamine, Tris(pentafluoroethyl)amine, Pentadecafluorotriethylamine, 1,1,2,2,2-Pentafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)ethanamine, Ethanamine, 1,1,2,2,2-pentafluoro-N,N-bis(pentafluoroethyl)-, Tri(perfluoroethyl)amine, Triethylamine, perfluoro-, N,N-Bis(pentafluoroethyl)-1,1,2,2,2-pentafluoroethanamine, tris(1,1,2,2,2-pentafluoroethyl)amine, tris-pentafluoroethyl-amine