Phenanthren-3-ylboronic acid, 98%
cas: 1188094-46-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Phenanthren-3-ylboronic acid, 98% (CAS 1188094-46-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g. Oferty producentów: Ambeed, BLDpharm, Fluorochem.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1220756-250mg |
| cas | 1188094-46-3 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 292,50 Pln | |
| Ambeed | 1g | 648,50 Pln | |
| Ambeed | 5g | 2117,00 Pln | |
| BLDpharm | 250mg | 281,04 Pln | |
| BLDpharm | 1g | 636,47 Pln | |
| BLDpharm | 5g | 2080,40 Pln | |
| Fluorochem | 250mg | 294,71 Pln | |
| Fluorochem | 1g | 664,37 Pln | |
| Fluorochem | 5g | 2174,25 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 2-3 tygodnie |
Phenanthren-3-ylboronic acid (CAS 1188094-46-3) to związek chemiczny o wzorze sumarycznym C14H11BO2 i masie molowej 222.05 g/mol. Nazwa systematyczna IUPAC: phenanthren-3-ylboronic acid. InChIKey: UPYVSYVLGOADDG-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H11BO2 |
|---|---|
| Masa molowa | 222.05 g/mol |
| Nazwa IUPAC | phenanthren-3-ylboronic acid |
| InChIKey | UPYVSYVLGOADDG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=CC3=CC=CC=C32)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Phenanthren-3-ylboronic acid, 3-phenanthreneboronic acid, 3-phenanthrenylboronic acid, phenanthren-3-yl-3-boronic acid, Phenanthren-3-ylboronicacid, B-3-Phenanthrenylboronic acid, phenanthrene-3-boronic acid, (phenanthren-3-yl)boronic acid, UPYVSYVLGOADDG-UHFFFAOYSA-N, Boronic acid, B-3-phenanthrenyl-