Phenethyl ferulate 99% (E)
cas: 71835-85-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Phenethyl ferulate 99% (E) (CAS 71835-85-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A814899-1mg |
| cas | 71835-85-3 |
| opakowanie | 1mg |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 1mg | 476,06 Pln | |
| Ambeed | 5mg | 587,31 Pln | |
| Ambeed | 10mg | 743,06 Pln | |
| Ambeed | 25mg | 937,75 Pln | |
| Ambeed | 50mg | 1121,31 Pln | |
| Ambeed | 100mg | 1338,25 Pln | |
| Ambeed | 250mg | 3235,06 Pln |
właściwości
| czystość | 99% (E) |
|---|---|
| czas dostawy | 2-3 tygodnie |
| nr katalogowy ambeed | A814899 |
2-phenylethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (CAS 71835-85-3) to związek chemiczny o wzorze sumarycznym C18H18O4 i masie molowej 298.3 g/mol. Nazwa systematyczna IUPAC: 2-phenylethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate. InChIKey: CZQNYPBIOHVQQN-CSKARUKUSA-N.
| Wzór sumaryczny | C18H18O4 |
|---|---|
| Masa molowa | 298.3 g/mol |
| Nazwa IUPAC | 2-phenylethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| InChIKey | CZQNYPBIOHVQQN-CSKARUKUSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)OCCC2=CC=CC=C2)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Phenylethyl 3-methylcaffeate, phenylethyl ferulate, 2-Phenylethyl 3-(4-hydroxy-3-methoxyphenyl)-2-propenoate, 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, 2-phenylethyl ester, 3-methylcaffeic acid phenylethyl ester, Phenethyl Ferulate, Caffeic Acid 3-Methyl Phenethyl Ester, Phenyethyl 3-methylcaffeate, Phenylethyl-3-methylcaffeate, Ferulic Acid Phenethyl Ester