Pinoresinol diMethyl ether 97%
cas: 29106-36-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Pinoresinol diMethyl ether 97% (CAS 29106-36-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mg, 25mg, 50mg, 100mg. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A102655-10mg |
| cas | 29106-36-3 |
| opakowanie | 10mg |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 10mg | 670,75 Pln | |
| Ambeed | 25mg | 1132,44 Pln | |
| Ambeed | 50mg | 1977,94 Pln | |
| Ambeed | 100mg | 3301,81 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 2-3 tygodnie |
| nr katalogowy ambeed | A102655 |
(3S,3aR,6S,6aR)-3,6-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan (CAS 29106-36-3) to związek chemiczny o wzorze sumarycznym C22H26O6 i masie molowej 386.4 g/mol. Nazwa systematyczna IUPAC: (3S,3aR,6S,6aR)-3,6-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan. InChIKey: PEUUVVGQIVMSAW-RZTYQLBFSA-N.
| Wzór sumaryczny | C22H26O6 |
|---|---|
| Masa molowa | 386.4 g/mol |
| Nazwa IUPAC | (3S,3aR,6S,6aR)-3,6-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan |
| InChIKey | PEUUVVGQIVMSAW-RZTYQLBFSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C=C4)OC)OC)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Pinoresinol dimethyl ether, (+)-Eudesmin, Eudesmin, Pinoresinol, O,O-dimethyl-, (+)-pinoresinol dimethyl ether, Di-O-methylpinoresnol, Dimethyl pinoresinol, O,O-Dimethylpinoresinol, 3,6-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro(3,4-c)furan, 3,6-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan