cas: 147489-06-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Pitavastatin Impurity 5 95% (CAS 147489-06-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 25g, 100g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A405187-250mg |
| cas | 147489-06-3 |
| opakowanie | 250mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 120,06 Pln | |
| Ambeed | 1g | 131,19 Pln | |
| Ambeed | 5g | 203,50 Pln | |
| Ambeed | 25g | 537,25 Pln | |
| Ambeed | 100g | 1616,38 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
| nr katalogowy ambeed | A405187 |
Tert-butyl 2-[(4R,6S)-6-[(E)-2-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 147489-06-3) to związek chemiczny o wzorze sumarycznym C32H36FNO4 i masie molowej 517.6 g/mol. Nazwa systematyczna IUPAC: tert-butyl 2-[(4R,6S)-6-[(E)-2-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: GTJPCLUSFUIHTP-KAAYJFPCSA-N.
| Wzór sumaryczny | C32H36FNO4 |
|---|---|
| Masa molowa | 517.6 g/mol |
| Nazwa IUPAC | tert-butyl 2-[(4R,6S)-6-[(E)-2-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | GTJPCLUSFUIHTP-KAAYJFPCSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)/C=C/C2=C(C3=CC=CC=C3N=C2C4CC4)C5=CC=C(C=C5)F)CC(=O)OC(C)(C)C)C |
Dane obliczone przez PubChem (NCBI)