cas: 1408168-73-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Potassium (2-benzyloxyethyl)trifluoroborate, 99.48% (CAS 1408168-73-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 g, 1 g, 5 g, 25 g, 500 mg, 250 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-W155163-10 g |
| cas | 1408168-73-9 |
| opakowanie | 10 g |
| dostępność | In stock |
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 g | 3226,84 Pln | |
| MedChemExpress | 1 g | 589,04 Pln | |
| MedChemExpress | 5 g | 2019,40 Pln | |
| MedChemExpress | 25 g | 6565,87 Pln | |
| MedChemExpress | 500 mg | 431,15 Pln | |
| MedChemExpress | 250 mg | 333,62 Pln | |
| MedChemExpress | 100 mg | 240,74 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.48% |
Potassium trifluoro(2-phenylmethoxyethyl)boranuide (CAS 1408168-73-9) to związek chemiczny o wzorze sumarycznym C9H11BF3KO i masie molowej 242.09 g/mol. Nazwa systematyczna IUPAC: potassium trifluoro(2-phenylmethoxyethyl)boranuide. InChIKey: XMZYLFXZFPICER-UHFFFAOYSA-N.
| Wzór sumaryczny | C9H11BF3KO |
|---|---|
| Masa molowa | 242.09 g/mol |
| Nazwa IUPAC | potassium trifluoro(2-phenylmethoxyethyl)boranuide |
| InChIKey | XMZYLFXZFPICER-UHFFFAOYSA-N |
| SMILES | [B-](CCOCC1=CC=CC=C1)(F)(F)F.[K+] |
Dane obliczone przez PubChem (NCBI)