Potassium trifluoro(2,2,2-trifluoroethyl)borate, 97%, 97%
cas: 1510778-85-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Potassium trifluoro(2,2,2-trifluoroethyl)borate, 97%, 97% (CAS 1510778-85-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11HXUC-50mg |
| cas | 1510778-85-4 |
| opakowanie | 50mg |
| dostępność | 50g |
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50mg | 88,40 Pln | |
| Chemat | 100mg | 107,60 Pln | |
| Chemat | 250mg | 174,80 Pln | |
| Chemat | 1g | 506,00 Pln | |
| Chemat | 5g | 1878,80 Pln | |
| Chemat | 10g | 3150,80 Pln | |
| Chemat | 25g | 6242,00 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
Potassium trifluoro(2,2,2-trifluoroethyl)boranuide (CAS 1510778-85-4) to związek chemiczny o wzorze sumarycznym C2H2BF6K i masie molowej 189.94 g/mol. Nazwa systematyczna IUPAC: potassium trifluoro(2,2,2-trifluoroethyl)boranuide. InChIKey: VRCXHAGAWUNMMJ-UHFFFAOYSA-N.
| Wzór sumaryczny | C2H2BF6K |
|---|---|
| Masa molowa | 189.94 g/mol |
| Nazwa IUPAC | potassium trifluoro(2,2,2-trifluoroethyl)boranuide |
| InChIKey | VRCXHAGAWUNMMJ-UHFFFAOYSA-N |
| SMILES | [B-](CC(F)(F)F)(F)(F)F.[K+] |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Potassium trifluoro(2,2,2-trifluoroethyl)borate, Potassium 2,2,2-trifluoroethane-2-trifluoroborate, Potassium;trifluoro(2,2,2-trifluoroethyl)boranuide, Potassium (2,2,2-Trifluoroethyl)trifluoroborate, VRCXHAGAWUNMMJ-UHFFFAOYSA-N, Potassiumtrifluoro(2,2,2-trifluoroethyl)borate, Potassium 2,2,2-trifluoroethane-1-trifluoroborate