cas: 56-54-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Quinidine (15% dihydroquinidine), 99.80% (CAS 56-54-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50 g, 25 g, 1 g, 10 g, 100 g, 100 mg, 5 g, 500 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-B1751-50 g |
| cas | 56-54-2 |
| opakowanie | 50 g |
| dostępność | Get quote |
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 50 g | 1573,57 Pln | |
| MedChemExpress | 25 g | 1327,44 Pln | |
| MedChemExpress | 1 g | 598,33 Pln | |
| MedChemExpress | 10 g | 983,78 Pln | |
| MedChemExpress | 100 g | 1866,14 Pln | |
| MedChemExpress | 100 mg | 407,93 Pln | |
| MedChemExpress | 5 g | 839,82 Pln | |
| MedChemExpress | 500 mg | 524,03 Pln |
| czas dostawy | ponad 3 tygodnie |
|---|---|
| czystość | 99.80% |
(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (CAS 56-54-2) to związek chemiczny o wzorze sumarycznym C20H24N2O2 i masie molowej 324.4 g/mol. Nazwa systematyczna IUPAC: (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol. InChIKey: LOUPRKONTZGTKE-LHHVKLHASA-N.
| Wzór sumaryczny | C20H24N2O2 |
|---|---|
| Masa molowa | 324.4 g/mol |
| Nazwa IUPAC | (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| InChIKey | LOUPRKONTZGTKE-LHHVKLHASA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)[C@@H]([C@H]3C[C@@H]4CCN3C[C@@H]4C=C)O |
Dane obliczone przez PubChem (NCBI)