cas: 1182129-77-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
RU-302, 98.72% (CAS 1182129-77-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 50 mg, 10 mg, 10mM/1mL, 25 mg, 5 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-124066-100 mg |
| cas | 1182129-77-6 |
| opakowanie | 100 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 5637,07 Pln | |
| MedChemExpress | 50 mg | 3575,14 Pln | |
| MedChemExpress | 10 mg | 1294,93 Pln | |
| MedChemExpress | 10mM/1mL | 1072,02 Pln | |
| MedChemExpress | 25 mg | 2279,46 Pln | |
| MedChemExpress | 5 mg | 793,38 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.72% |
[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]phenyl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (CAS 1182129-77-6) to związek chemiczny o wzorze sumarycznym C24H24F3N3O2S i masie molowej 475.5 g/mol. Nazwa systematyczna IUPAC: [2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]phenyl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone. InChIKey: IZHRNXCFYZERFF-UHFFFAOYSA-N.
| Wzór sumaryczny | C24H24F3N3O2S |
|---|---|
| Masa molowa | 475.5 g/mol |
| Nazwa IUPAC | [2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]phenyl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| InChIKey | IZHRNXCFYZERFF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CSC2=CC=CC=C2C(=O)N3CCN(CC3)C4=CC=CC(=C4)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)