Rel-1-(tert-butyl) 3-methyl (2S,3R)-2-methylazetidine-1,3-dicarboxylate, 97%
cas: 2733101-53-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Rel-1-(tert-butyl) 3-methyl (2S,3R)-2-methylazetidine-1,3-dicarboxylate, 97% (CAS 2733101-53-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 500mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch135T0F-100mg |
| cas | 2733101-53-4 |
| opakowanie | 100mg |
| dostępność | 5g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 698,00 Pln | |
| Chemat | 250mg | 1077,20 Pln | |
| Chemat | 500mg | 1754,00 Pln | |
| Chemat | 1g | 2598,80 Pln | |
| Chemat | 5g | 7667,60 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
1-O-tert-butyl 3-O-methyl (2S,3R)-2-methylazetidine-1,3-dicarboxylate (CAS 2733101-53-4) to związek chemiczny o wzorze sumarycznym C11H19NO4 i masie molowej 229.27 g/mol. Nazwa systematyczna IUPAC: 1-O-tert-butyl 3-O-methyl (2S,3R)-2-methylazetidine-1,3-dicarboxylate. InChIKey: XCIXLYKMSJVCGF-JGVFFNPUSA-N.
| Wzór sumaryczny | C11H19NO4 |
|---|---|
| Masa molowa | 229.27 g/mol |
| Nazwa IUPAC | 1-O-tert-butyl 3-O-methyl (2S,3R)-2-methylazetidine-1,3-dicarboxylate |
| InChIKey | XCIXLYKMSJVCGF-JGVFFNPUSA-N |
| SMILES | C[C@H]1[C@@H](CN1C(=O)OC(C)(C)C)C(=O)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
O1-tert-butyl O3-methyl (2S,3R)-2-methylazetidine-1,3-dicarboxylate, Methyl (2S,3R)-1-Boc-2-methylazetidine-3-carboxylate, 1-tert-butyl 3-methyl trans-2-methylazetidine-1,3-dicarboxylate, Rel-1-(tert-butyl) 3-methyl (2S,3R)-2-methylazetidine-1,3-dicarboxylate, Rel-1-(t, 1-O-tert-butyl 3-O-methyl (2R,3S)-2-methylazetidine-1,3-dicarboxylate, 1-tert-butyl 3-methyl (2S,3R)-2-methylazetidine-1,3-dicarboxylate, Methyl trans-1-Boc-2-methylazetidine-3-carboxylate, O1-t-butyl O3-methyl trans-2-methylaZetidine-1,3-dicarboxylate, 1-O-tert-butyl 3-O-methyl (2S,3R)-2-methylazetidine-1,3-dicarboxylate