Rezivertinib, 99.62%
cas: 1835667-12-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Rezivertinib, 99.62% (CAS 1835667-12-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 mg, 100 mg, 5 g, 500 mg, 25 mg, 50 mg, 10mM/1mL, 5 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-109189-10 mg |
| cas | 1835667-12-3 |
| opakowanie | 10 mg |
| dostępność | In stock |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 mg | 1290,29 Pln | |
| MedChemExpress | 100 mg | 4438,92 Pln | |
| MedChemExpress | 5 g | 27106,28 Pln | |
| MedChemExpress | 500 mg | 9301,19 Pln | |
| MedChemExpress | 25 mg | 2233,02 Pln | |
| MedChemExpress | 50 mg | 3138,60 Pln | |
| MedChemExpress | 10mM/1mL | 993,07 Pln | |
| MedChemExpress | 5 mg | 937,34 Pln | |
| MedChemExpress | 1 g | 12979,24 Pln |
właściwości
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.62% |
N-[2-[2-(dimethylamino)ethoxy]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide (CAS 1835667-12-3) to związek chemiczny o wzorze sumarycznym C27H30N6O3 i masie molowej 486.6 g/mol. Nazwa systematyczna IUPAC: N-[2-[2-(dimethylamino)ethoxy]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide. InChIKey: BPMZUKYFIDPLEA-UHFFFAOYSA-N.
| Wzór sumaryczny | C27H30N6O3 |
|---|---|
| Masa molowa | 486.6 g/mol |
| Nazwa IUPAC | N-[2-[2-(dimethylamino)ethoxy]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| InChIKey | BPMZUKYFIDPLEA-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=NC(=NC=C3)NC4=CC(=C(C=C4OC)OCCN(C)C)NC(=O)C=C |
Dane obliczone przez PubChem (NCBI)