Rhodamine B hydrazide, 99.87%
cas: 74317-53-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Rhodamine B hydrazide, 99.87% (CAS 74317-53-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 25 mg, 5 mg, 50 mg, 10 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-123645-10mM/1mL |
| cas | 74317-53-6 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 301,12 Pln | |
| MedChemExpress | 25 mg | 681,92 Pln | |
| MedChemExpress | 5 mg | 287,18 Pln | |
| MedChemExpress | 50 mg | 1016,29 Pln | |
| MedChemExpress | 10 mg | 398,64 Pln | |
| MedChemExpress | 100 mg | 1559,64 Pln |
właściwości
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.87% |
2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one (CAS 74317-53-6) to związek chemiczny o wzorze sumarycznym C28H32N4O2 i masie molowej 456.6 g/mol. Nazwa systematyczna IUPAC: 2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one. InChIKey: WTDHTIVYKKLOTC-UHFFFAOYSA-N.
| Wzór sumaryczny | C28H32N4O2 |
|---|---|
| Masa molowa | 456.6 g/mol |
| Nazwa IUPAC | 2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
| InChIKey | WTDHTIVYKKLOTC-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)N(CC)CC)C5=CC=CC=C5C(=O)N3N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Rhodamine B hydrazide, 2-amino-3',6'-bis(diethylamino)spiro[isoindoline-1,9'-xanthen]-3-one, 2-amino-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one, s10743, 2-amino-3',6'-bis(diethylamino)-2,3-dihydrospiro[isoindole-1,9'-xanthen]-3-one, Spiro[1H-isoindole-1,9'-[9H]xanthen]-3(2H)-one, 2-amino-3',6'-bis(diethylamino)-, Rhodamine B CU2+ sen, Rhodamine B Cu2+ sensor, orb1943488, 2-amino-12,15-bis(diethylamino)spiro[isoindoline-3,9'-xanthene]-1-one