S-(Trifluoromethyl) 4-methylbenzenesulfonothioate, 97%
cas: 15223-20-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
S-(Trifluoromethyl) 4-methylbenzenesulfonothioate, 97% (CAS 15223-20-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Ambeed, BLDpharm, Chemat, Fluorochem.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1375457-100mg |
| cas | 15223-20-8 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 248,00 Pln | |
| Ambeed | 250mg | 387,06 Pln | |
| Ambeed | 1g | 793,12 Pln | |
| Ambeed | 5g | 2350,62 Pln | |
| BLDpharm | 100mg | 264,38 Pln | |
| BLDpharm | 250mg | 414,32 Pln | |
| BLDpharm | 1g | 853,06 Pln | |
| BLDpharm | 5g | 2530,24 Pln | |
| Chemat | 100mg | 198,80 Pln | |
| Chemat | 250mg | 304,40 Pln | |
| Chemat | 1g | 630,80 Pln | |
| Chemat | 5g | 1797,20 Pln | |
| Fluorochem | 250mg | 383,22 Pln | |
| Fluorochem | 1g | 799,74 Pln | |
| Fluorochem | 5g | 2361,69 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 2-3 tygodnie |
1-methyl-4-(trifluoromethylsulfanylsulfonyl)benzene (CAS 15223-20-8) to związek chemiczny o wzorze sumarycznym C8H7F3O2S2 i masie molowej 256.3 g/mol. Nazwa systematyczna IUPAC: 1-methyl-4-(trifluoromethylsulfanylsulfonyl)benzene. InChIKey: BMWAIPXLPUNZLV-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H7F3O2S2 |
|---|---|
| Masa molowa | 256.3 g/mol |
| Nazwa IUPAC | 1-methyl-4-(trifluoromethylsulfanylsulfonyl)benzene |
| InChIKey | BMWAIPXLPUNZLV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)SC(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
S-(Trifluoromethyl) 4-methylbenzene-1-sulfonothioate, s-(trifluoromethyl) 4-methylbenzenesulfonothioate, S-Trifluoromethyl p-toluenethiosulfonate, 4-Methylbenzene-1-thiosulfonic acid S-trifluoromethyl ester, 1-methyl-4-(trifluoromethylsulfanylsulfonyl)benzene, p-Toluenesulfonic acid, thio-, S-trifluoromethyl ester, 1-methyl-4-{[(trifluoromethyl)sulfanyl]sulfonyl}benzene, p-Toluenesulfonic acid, S-trifluoromethyl ester, p-Toluenesulfonic acid, S-(trifluoromethyl) ester, S-Trifluoromethyl 4-methylbenzene-1-sulfonothioate