cas: 1450881-55-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
SAR-20347, 97.27% (CAS 1450881-55-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 5 mg, 100 mg, 10 mg, 25 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-100895-10mM/1mL |
| cas | 1450881-55-6 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 593,69 Pln | |
| MedChemExpress | 5 mg | 551,89 Pln | |
| MedChemExpress | 100 mg | 3719,10 Pln | |
| MedChemExpress | 10 mg | 816,60 Pln | |
| MedChemExpress | 25 mg | 1513,20 Pln | |
| MedChemExpress | 50 mg | 2279,46 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 97.27% |
2-(2-chloro-6-fluorophenyl)-5-[4-(morpholine-4-carbonyl)anilino]-1,3-oxazole-4-carboxamide (CAS 1450881-55-6) to związek chemiczny o wzorze sumarycznym C21H18ClFN4O4 i masie molowej 444.8 g/mol. Nazwa systematyczna IUPAC: 2-(2-chloro-6-fluorophenyl)-5-[4-(morpholine-4-carbonyl)anilino]-1,3-oxazole-4-carboxamide. InChIKey: HEDPDFHTQKEORT-UHFFFAOYSA-N.
| Wzór sumaryczny | C21H18ClFN4O4 |
|---|---|
| Masa molowa | 444.8 g/mol |
| Nazwa IUPAC | 2-(2-chloro-6-fluorophenyl)-5-[4-(morpholine-4-carbonyl)anilino]-1,3-oxazole-4-carboxamide |
| InChIKey | HEDPDFHTQKEORT-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC=C(C=C2)NC3=C(N=C(O3)C4=C(C=CC=C4Cl)F)C(=O)N |
Dane obliczone przez PubChem (NCBI)