cas: 154566-12-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
SB 204990, 99.75% (CAS 154566-12-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 mg, 50 mg, 100 mg, 10mM/1mL, 5 mg, 10 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-16450-25 mg |
| cas | 154566-12-8 |
| opakowanie | 25 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 mg | 2181,94 Pln | |
| MedChemExpress | 50 mg | 3551,92 Pln | |
| MedChemExpress | 100 mg | 5609,21 Pln | |
| MedChemExpress | 10mM/1mL | 728,36 Pln | |
| MedChemExpress | 5 mg | 672,64 Pln | |
| MedChemExpress | 10 mg | 1081,31 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.75% |
2-[(3S,5R)-5-[6-(2,4-dichlorophenyl)hexyl]-3-hydroxy-2-oxooxolan-3-yl]acetic acid (CAS 154566-12-8) to związek chemiczny o wzorze sumarycznym C18H22Cl2O5 i masie molowej 389.3 g/mol. Nazwa systematyczna IUPAC: 2-[(3S,5R)-5-[6-(2,4-dichlorophenyl)hexyl]-3-hydroxy-2-oxooxolan-3-yl]acetic acid. InChIKey: YTRNLFYTHYWDAU-KDOFPFPSSA-N.
| Wzór sumaryczny | C18H22Cl2O5 |
|---|---|
| Masa molowa | 389.3 g/mol |
| Nazwa IUPAC | 2-[(3S,5R)-5-[6-(2,4-dichlorophenyl)hexyl]-3-hydroxy-2-oxooxolan-3-yl]acetic acid |
| InChIKey | YTRNLFYTHYWDAU-KDOFPFPSSA-N |
| SMILES | C1[C@H](OC(=O)[C@]1(CC(=O)O)O)CCCCCCC2=C(C=C(C=C2)Cl)Cl |
Dane obliczone przez PubChem (NCBI)