cas: 3232-36-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
SCS, 99.64% (CAS 3232-36-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 mg, 100 mg, 50 mg, 10mM/1mL, 5 mg, 10 mg, 500 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-103528-25 mg |
| cas | 3232-36-8 |
| opakowanie | 25 mg |
| dostępność | In stock |
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 mg | 431,15 Pln | |
| MedChemExpress | 100 mg | 733,01 Pln | |
| MedChemExpress | 50 mg | 556,54 Pln | |
| MedChemExpress | 10mM/1mL | 384,71 Pln | |
| MedChemExpress | 5 mg | 240,74 Pln | |
| MedChemExpress | 10 mg | 301,12 Pln | |
| MedChemExpress | 500 mg | 1513,20 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.64% |
2-hydroxy-N-[(E)-(2-hydroxyphenyl)methylideneamino]benzamide (CAS 3232-36-8) to związek chemiczny o wzorze sumarycznym C14H12N2O3 i masie molowej 256.26 g/mol. Nazwa systematyczna IUPAC: 2-hydroxy-N-[(E)-(2-hydroxyphenyl)methylideneamino]benzamide. InChIKey: OMCYEZUIYGPHDJ-OQLLNIDSSA-N.
| Wzór sumaryczny | C14H12N2O3 |
|---|---|
| Masa molowa | 256.26 g/mol |
| Nazwa IUPAC | 2-hydroxy-N-[(E)-(2-hydroxyphenyl)methylideneamino]benzamide |
| InChIKey | OMCYEZUIYGPHDJ-OQLLNIDSSA-N |
| SMILES | C1=CC=C(C(=C1)/C=N/NC(=O)C2=CC=CC=C2O)O |
Dane obliczone przez PubChem (NCBI)