cas: 129-56-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
SP600125, 99.73% (CAS 129-56-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 500 mg, 10 mg, 50 mg, 10mM/1mL, 200 mg, 5 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-12041-100 mg |
| cas | 129-56-6 |
| opakowanie | 100 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 551,89 Pln | |
| MedChemExpress | 500 mg | 983,78 Pln | |
| MedChemExpress | 10 mg | 361,49 Pln | |
| MedChemExpress | 50 mg | 407,93 Pln | |
| MedChemExpress | 10mM/1mL | 384,71 Pln | |
| MedChemExpress | 200 mg | 649,42 Pln | |
| MedChemExpress | 5 mg | 273,25 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.73% |
14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one (CAS 129-56-6) to związek chemiczny o wzorze sumarycznym C14H8N2O i masie molowej 220.23 g/mol. Nazwa systematyczna IUPAC: 14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one. InChIKey: ACPOUJIDANTYHO-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H8N2O |
|---|---|
| Masa molowa | 220.23 g/mol |
| Nazwa IUPAC | 14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
| InChIKey | ACPOUJIDANTYHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=NNC4=CC=CC(=C43)C2=O |
Dane obliczone przez PubChem (NCBI)