cas: 2259624-71-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
STING agonist-12, 98.26% (CAS 2259624-71-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 mg, 100 mg, 5 mg, 50 mg, 25 mg, 10mM/1mL. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-147010-10 mg |
| cas | 2259624-71-8 |
| opakowanie | 10 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 mg | 863,04 Pln | |
| MedChemExpress | 100 mg | 4007,03 Pln | |
| MedChemExpress | 5 mg | 598,33 Pln | |
| MedChemExpress | 50 mg | 2567,39 Pln | |
| MedChemExpress | 25 mg | 1657,16 Pln | |
| MedChemExpress | 10mM/1mL | 640,13 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.26% |
1-[(2-chloro-6-fluorophenyl)methyl]-3,3-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]indole-6-carboxamide (CAS 2259624-71-8) to związek chemiczny o wzorze sumarycznym C25H19ClF4N2O2 i masie molowej 490.9 g/mol. Nazwa systematyczna IUPAC: 1-[(2-chloro-6-fluorophenyl)methyl]-3,3-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]indole-6-carboxamide. InChIKey: OEBVYNULNKSONR-UHFFFAOYSA-N.
| Wzór sumaryczny | C25H19ClF4N2O2 |
|---|---|
| Masa molowa | 490.9 g/mol |
| Nazwa IUPAC | 1-[(2-chloro-6-fluorophenyl)methyl]-3,3-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]indole-6-carboxamide |
| InChIKey | OEBVYNULNKSONR-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)C(=O)NCC3=C(C=C(C=C3F)F)F)N(C1=O)CC4=C(C=CC=C4Cl)F)C |
Dane obliczone przez PubChem (NCBI)