cas: 61281-38-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Schisandrin A, 99.89% (CAS 61281-38-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 25 mg, 100 mg, 5 mg, 10 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-N0693-10mM/1mL |
| cas | 61281-38-7 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 361,49 Pln | |
| MedChemExpress | 25 mg | 542,60 Pln | |
| MedChemExpress | 100 mg | 839,82 Pln | |
| MedChemExpress | 5 mg | 263,96 Pln | |
| MedChemExpress | 10 mg | 342,91 Pln | |
| MedChemExpress | 50 mg | 672,64 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.89% |
3,4,5,14,15,16-hexamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene (CAS 61281-38-7) to związek chemiczny o wzorze sumarycznym C24H32O6 i masie molowej 416.5 g/mol. Nazwa systematyczna IUPAC: 3,4,5,14,15,16-hexamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene. InChIKey: JEJFTTRHGBKKEI-UHFFFAOYSA-N.
| Wzór sumaryczny | C24H32O6 |
|---|---|
| Masa molowa | 416.5 g/mol |
| Nazwa IUPAC | 3,4,5,14,15,16-hexamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene |
| InChIKey | JEJFTTRHGBKKEI-UHFFFAOYSA-N |
| SMILES | CC1CC2=CC(=C(C(=C2C3=C(C(=C(C=C3CC1C)OC)OC)OC)OC)OC)OC |
Dane obliczone przez PubChem (NCBI)