cas: 1315378-72-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Scrambled 10Panx trifluoroacetate (CAS 1315378-72-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 10mg, 25mg, 50mg. Oferty producentów: Biosynth.
| producent | Biosynth |
|---|---|
| nr katalogowy | BS183755-100mg |
| cas | 1315378-72-3 |
| opakowanie | 100mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Biosynth | 100mg | cena na żądanie | |
| Biosynth | 10mg | cena na żądanie | |
| Biosynth | 25mg | cena na żądanie | |
| Biosynth | 50mg | cena na żądanie |
| kategoria | Life Sciences |
|---|---|
| podkategoria 1 | Ligands |
| czystość | No data |
| czas dostawy | 1-2 tygodnie |
2-[[2-[2-[[5-amino-2-[2-[[2-[[2-[[2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-hydroxypropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-oxopentanoyl]amino]propanoylamino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (CAS 1315378-72-3) to związek chemiczny o wzorze sumarycznym C58H79N15O16 i masie molowej 1242.3 g/mol. Nazwa systematyczna IUPAC: 2-[[2-[2-[[5-amino-2-[2-[[2-[[2-[[2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-hydroxypropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-oxopentanoyl]amino]propanoylamino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid. InChIKey: VNQGVHMGXBRHRA-UHFFFAOYSA-N.
| Wzór sumaryczny | C58H79N15O16 |
|---|---|
| Masa molowa | 1242.3 g/mol |
| Nazwa IUPAC | 2-[[2-[2-[[5-amino-2-[2-[[2-[[2-[[2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-hydroxypropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-oxopentanoyl]amino]propanoylamino]-3-carboxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| InChIKey | VNQGVHMGXBRHRA-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)NC(CC1=CC=C(C=C1)O)C(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)NC(C)C(=O)NC(CCC(=O)N)C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O)NC(=O)C(CO)NC(=O)C(CC4=CC=CC=C4)N |
Dane obliczone przez PubChem (NCBI)