cas: 1230487-00-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Siponimod, 99.95% (CAS 1230487-00-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 100 mg, 5 mg, 10 mg, 1 g, 500 mg, 50 mg, 25 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-12355-10mM/1mL |
| cas | 1230487-00-9 |
| opakowanie | 10mM/1mL |
| dostępność | Get quote |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 477,59 Pln | |
| MedChemExpress | 100 mg | 2019,40 Pln | |
| MedChemExpress | 5 mg | 435,79 Pln | |
| MedChemExpress | 10 mg | 593,69 Pln | |
| MedChemExpress | 1 g | 10675,81 Pln | |
| MedChemExpress | 500 mg | 6454,42 Pln | |
| MedChemExpress | 50 mg | 1489,98 Pln | |
| MedChemExpress | 25 mg | 886,26 Pln |
| czas dostawy | ponad 3 tygodnie |
|---|---|
| czystość | 99.95% |
1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidine-3-carboxylic acid (CAS 1230487-00-9) to związek chemiczny o wzorze sumarycznym C29H35F3N2O3 i masie molowej 516.6 g/mol. Nazwa systematyczna IUPAC: 1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidine-3-carboxylic acid. InChIKey: KIHYPELVXPAIDH-HNSNBQBZSA-N.
| Wzór sumaryczny | C29H35F3N2O3 |
|---|---|
| Masa molowa | 516.6 g/mol |
| Nazwa IUPAC | 1-[[4-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-2-ethylphenyl]methyl]azetidine-3-carboxylic acid |
| InChIKey | KIHYPELVXPAIDH-HNSNBQBZSA-N |
| SMILES | CCC1=C(C=CC(=C1)/C(=N/OCC2=CC(=C(C=C2)C3CCCCC3)C(F)(F)F)/C)CN4CC(C4)C(=O)O |
Dane obliczone przez PubChem (NCBI)