cas: 1308672-74-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Sulfatinib, 99.52% (CAS 1308672-74-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1 mg, 5 mg, 10 mg, 10mM/1mL, 50 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-12297-1 mg |
| cas | 1308672-74-3 |
| opakowanie | 1 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 1 mg | 361,49 Pln | |
| MedChemExpress | 5 mg | 551,89 Pln | |
| MedChemExpress | 10 mg | 695,86 Pln | |
| MedChemExpress | 10mM/1mL | 575,11 Pln | |
| MedChemExpress | 50 mg | 1513,20 Pln | |
| MedChemExpress | 100 mg | 2279,46 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.52% |
N-[2-(dimethylamino)ethyl]-1-[3-[[4-[(2-methyl-1H-indol-5-yl)oxy]pyrimidin-2-yl]amino]phenyl]methanesulfonamide (CAS 1308672-74-3) to związek chemiczny o wzorze sumarycznym C24H28N6O3S i masie molowej 480.6 g/mol. Nazwa systematyczna IUPAC: N-[2-(dimethylamino)ethyl]-1-[3-[[4-[(2-methyl-1H-indol-5-yl)oxy]pyrimidin-2-yl]amino]phenyl]methanesulfonamide. InChIKey: TTZSNFLLYPYKIL-UHFFFAOYSA-N.
| Wzór sumaryczny | C24H28N6O3S |
|---|---|
| Masa molowa | 480.6 g/mol |
| Nazwa IUPAC | N-[2-(dimethylamino)ethyl]-1-[3-[[4-[(2-methyl-1H-indol-5-yl)oxy]pyrimidin-2-yl]amino]phenyl]methanesulfonamide |
| InChIKey | TTZSNFLLYPYKIL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=CC(=C2)OC3=NC(=NC=C3)NC4=CC=CC(=C4)CS(=O)(=O)NCCN(C)C |
Dane obliczone przez PubChem (NCBI)