cas: 2236573-39-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Sulfo-Cyanine7 amine, 95% (CAS 2236573-39-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 25mg, 50mg, 100mg. Oferty producentów: Lumiprobe.
| producent | Lumiprobe |
|---|---|
| nr katalogowy | LP-x53C0-1mg |
| cas | 2236573-39-8 |
| opakowanie | 1mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Lumiprobe | 1mg | 638,23 Pln | |
| Lumiprobe | 5mg | 1512,88 Pln | |
| Lumiprobe | 25mg | 3344,25 Pln | |
| Lumiprobe | 50mg | 6174,00 Pln | |
| Lumiprobe | 100mg | 9672,60 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 2 weeks |
1-[6-(6-azaniumylhexylamino)-6-oxohexyl]-3,3-dimethyl-2-[2-[3-[2-(1,3,3-trimethyl-5-sulfonatoindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole-5-sulfonate (CAS 2236573-39-8) to związek chemiczny o wzorze sumarycznym C43H58N4O7S2 i masie molowej 807.1 g/mol. Nazwa systematyczna IUPAC: 1-[6-(6-azaniumylhexylamino)-6-oxohexyl]-3,3-dimethyl-2-[2-[3-[2-(1,3,3-trimethyl-5-sulfonatoindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole-5-sulfonate. InChIKey: KMPXHFWUNXBKET-UHFFFAOYSA-N.
| Wzór sumaryczny | C43H58N4O7S2 |
|---|---|
| Masa molowa | 807.1 g/mol |
| Nazwa IUPAC | 1-[6-(6-azaniumylhexylamino)-6-oxohexyl]-3,3-dimethyl-2-[2-[3-[2-(1,3,3-trimethyl-5-sulfonatoindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole-5-sulfonate |
| InChIKey | KMPXHFWUNXBKET-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)S(=O)(=O)[O-])[N+](=C1C=CC3=CC(=CC=C4C(C5=C(N4CCCCCC(=O)NCCCCCC[NH3+])C=CC(=C5)S(=O)(=O)[O-])(C)C)CCC3)C)C |
Dane obliczone przez PubChem (NCBI)