cas: 1158838-45-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
TCS7010, 99.82% (CAS 1158838-45-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 25 mg, 10 mg, 50 mg, 100 mg, 250 mg, 5 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-70061-10mM/1mL |
| cas | 1158838-45-9 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 496,16 Pln | |
| MedChemExpress | 25 mg | 983,78 Pln | |
| MedChemExpress | 10 mg | 575,11 Pln | |
| MedChemExpress | 50 mg | 1462,12 Pln | |
| MedChemExpress | 100 mg | 2135,50 Pln | |
| MedChemExpress | 250 mg | 4150,99 Pln | |
| MedChemExpress | 5 mg | 407,93 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.82% |
N-(2-chlorophenyl)-4-[[2-[4-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]anilino]-5-fluoropyrimidin-4-yl]amino]benzamide (CAS 1158838-45-9) to związek chemiczny o wzorze sumarycznym C31H31ClFN7O2 i masie molowej 588.1 g/mol. Nazwa systematyczna IUPAC: N-(2-chlorophenyl)-4-[[2-[4-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]anilino]-5-fluoropyrimidin-4-yl]amino]benzamide. InChIKey: AKSIZPIFQAYJGF-UHFFFAOYSA-N.
| Wzór sumaryczny | C31H31ClFN7O2 |
|---|---|
| Masa molowa | 588.1 g/mol |
| Nazwa IUPAC | N-(2-chlorophenyl)-4-[[2-[4-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]anilino]-5-fluoropyrimidin-4-yl]amino]benzamide |
| InChIKey | AKSIZPIFQAYJGF-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C(=O)CC2=CC=C(C=C2)NC3=NC=C(C(=N3)NC4=CC=C(C=C4)C(=O)NC5=CC=CC=C5Cl)F |
Dane obliczone przez PubChem (NCBI)