cas: 1609960-30-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
TH287, 98.99% (CAS 1609960-30-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 mg, 50 mg, 100 mg, 25 mg, 5 mg, 10mM/1mL. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-16965-10 mg |
| cas | 1609960-30-6 |
| opakowanie | 10 mg |
| dostępność | In stock |
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 mg | 719,08 Pln | |
| MedChemExpress | 50 mg | 1907,94 Pln | |
| MedChemExpress | 100 mg | 2637,05 Pln | |
| MedChemExpress | 25 mg | 1322,80 Pln | |
| MedChemExpress | 5 mg | 519,38 Pln | |
| MedChemExpress | 10mM/1mL | 556,54 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 98.99% |
6-(2,3-dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine (CAS 1609960-30-6) to związek chemiczny o wzorze sumarycznym C11H10Cl2N4 i masie molowej 269.13 g/mol. Nazwa systematyczna IUPAC: 6-(2,3-dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine. InChIKey: URWCXPXBBITYLR-UHFFFAOYSA-N.
| Wzór sumaryczny | C11H10Cl2N4 |
|---|---|
| Masa molowa | 269.13 g/mol |
| Nazwa IUPAC | 6-(2,3-dichlorophenyl)-4-N-methylpyrimidine-2,4-diamine |
| InChIKey | URWCXPXBBITYLR-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=NC(=C1)C2=C(C(=CC=C2)Cl)Cl)N |
Dane obliczone przez PubChem (NCBI)