cas: 1358575-02-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
TP-024, 99.96% (CAS 1358575-02-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50 mg, 10 mg, 25 mg, 5 mg, 100 mg, 10mM/1mL. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-101787-50 mg |
| cas | 1358575-02-6 |
| opakowanie | 50 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 50 mg | 3189,68 Pln | |
| MedChemExpress | 10 mg | 886,26 Pln | |
| MedChemExpress | 25 mg | 1847,57 Pln | |
| MedChemExpress | 5 mg | 551,89 Pln | |
| MedChemExpress | 100 mg | 4894,03 Pln | |
| MedChemExpress | 10mM/1mL | 593,69 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.96% |
4-[3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-5-methyl-1,2,4-triazol-1-yl]-2-methylbenzamide (CAS 1358575-02-6) to związek chemiczny o wzorze sumarycznym C19H16F4N4O i masie molowej 392.3 g/mol. Nazwa systematyczna IUPAC: 4-[3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-5-methyl-1,2,4-triazol-1-yl]-2-methylbenzamide. InChIKey: TYXSIXOYTBHZFA-UHFFFAOYSA-N.
| Wzór sumaryczny | C19H16F4N4O |
|---|---|
| Masa molowa | 392.3 g/mol |
| Nazwa IUPAC | 4-[3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-5-methyl-1,2,4-triazol-1-yl]-2-methylbenzamide |
| InChIKey | TYXSIXOYTBHZFA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C(=NC(=N2)CC3=CC(=CC(=C3)F)C(F)(F)F)C)C(=O)N |
Dane obliczone przez PubChem (NCBI)