cas: 951395-08-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Tafamidis meglumine, 98% (CAS 951395-08-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1167264-1mg |
| cas | 951395-08-7 |
| opakowanie | 1mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 1mg | 231,31 Pln | |
| Ambeed | 5mg | 259,12 Pln | |
| Ambeed | 10mg | 320,31 Pln | |
| Ambeed | 25mg | 387,06 Pln | |
| Ambeed | 50mg | 481,62 Pln | |
| Ambeed | 100mg | 565,06 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 2-3 tygodnie |
2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (CAS 951395-08-7) to związek chemiczny o wzorze sumarycznym C21H24Cl2N2O8 i masie molowej 503.3 g/mol. Nazwa systematyczna IUPAC: 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol. InChIKey: DQJDBUPLRMRBAB-WZTVWXICSA-N.
| Wzór sumaryczny | C21H24Cl2N2O8 |
|---|---|
| Masa molowa | 503.3 g/mol |
| Nazwa IUPAC | 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| InChIKey | DQJDBUPLRMRBAB-WZTVWXICSA-N |
| SMILES | CNC[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O.C1=CC2=C(C=C1C(=O)O)OC(=N2)C3=CC(=CC(=C3)Cl)Cl |
Dane obliczone przez PubChem (NCBI)