cas: 480424-71-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Tert-Butyl (2-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Phenyl) Carbonate, 98%, 98% (CAS 480424-71-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 500mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11I9R4-500mg |
| cas | 480424-71-3 |
| opakowanie | 500mg |
| dostępność | 10g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 500mg | 160,40 Pln | |
| Chemat | 250mg | 107,60 Pln | |
| Chemat | 1g | 227,60 Pln | |
| Chemat | 5g | 760,40 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Tert-butyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate (CAS 480424-71-3) to związek chemiczny o wzorze sumarycznym C17H25BO5 i masie molowej 320.2 g/mol. Nazwa systematyczna IUPAC: tert-butyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate. InChIKey: JWSZKSKLMRKJHM-UHFFFAOYSA-N.
| Wzór sumaryczny | C17H25BO5 |
|---|---|
| Masa molowa | 320.2 g/mol |
| Nazwa IUPAC | tert-butyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate |
| InChIKey | JWSZKSKLMRKJHM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2OC(=O)OC(C)(C)C |
Dane obliczone przez PubChem (NCBI)