Tetraethyleneglycol di(2-ethylhexanoate), 95%
cas: 18268-70-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Tetraethyleneglycol di(2-ethylhexanoate), 95% (CAS 18268-70-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11352X-250mg |
| cas | 18268-70-7 |
| opakowanie | 250mg |
| dostępność | 10g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 611,60 Pln | |
| Chemat | 1g | 837,20 Pln | |
| Chemat | 5g | 2382,80 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
2-[2-[2-[2-(2-ethylhexanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 2-ethylhexanoate (CAS 18268-70-7) to związek chemiczny o wzorze sumarycznym C24H46O7 i masie molowej 446.6 g/mol. Nazwa systematyczna IUPAC: 2-[2-[2-[2-(2-ethylhexanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 2-ethylhexanoate. InChIKey: GYHPTPQZVBYHLC-UHFFFAOYSA-N.
| Wzór sumaryczny | C24H46O7 |
|---|---|
| Masa molowa | 446.6 g/mol |
| Nazwa IUPAC | 2-[2-[2-[2-(2-ethylhexanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 2-ethylhexanoate |
| InChIKey | GYHPTPQZVBYHLC-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)OCCOCCOCCOCCOC(=O)C(CC)CCCC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Tetraethylene glycol di(2-ethylhexanoate), Flexol 4GO, Plasticizer 4GO, 3,6,9-Trioxaundecamethylene bis(2-ethylhexanoate), 2-[2-[2-[2-(2-ethylhexanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 2-ethylhexanoate, Hexanoic acid, 2-ethyl-, diester with tetraethylene glycol, Hexanoic acid, 2-ethyl-, 1,1'-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] ester, Hexanoic acid, 2-ethyl-, oxybis(2,1-ethanediyloxy-2,1-ethanediyl) ester, ((Oxybis(ethane-2,1-diyl))bis(oxy))bis(ethane-2,1-diyl) bis(2-ethylhexanoate), Hexanoic acid, 2-ethyl-, oxybis(2,1-ethyldiyloxy-2,1-ethanediyl)ester