Tetramethylammonium trifluoromethanethiolate, 95%
cas: 515823-30-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Tetramethylammonium trifluoromethanethiolate, 95% (CAS 515823-30-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 5g, 1g, 50mg, 100mg. Oferty producentów: Combi-blocks, Fluorochem.
| producent | Combi-blocks |
|---|---|
| nr katalogowy | HA-0707-250mg |
| cas | 515823-30-0 |
| opakowanie | 250mg |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Combi-blocks | 250mg | cena na żądanie | |
| Combi-blocks | 5g | cena na żądanie | |
| Combi-blocks | 1g | cena na żądanie | |
| Fluorochem | 50mg | 227,02 Pln | |
| Fluorochem | 100mg | 320,74 Pln | |
| Fluorochem | 250mg | 643,54 Pln | |
| Fluorochem | 1g | 1726,49 Pln | |
| Fluorochem | 5g | 4209,99 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie, tylko jeżeli na stocku, by sprawdzić kliknij dostępność |
Tetramethylazanium;trifluoromethanethiolate (CAS 515823-30-0) to związek chemiczny o wzorze sumarycznym C5H12F3NS i masie molowej 175.22 g/mol. Nazwa systematyczna IUPAC: tetramethylazanium;trifluoromethanethiolate. InChIKey: LTONLRVDOIFITJ-UHFFFAOYSA-M.
| Wzór sumaryczny | C5H12F3NS |
|---|---|
| Masa molowa | 175.22 g/mol |
| Nazwa IUPAC | tetramethylazanium;trifluoromethanethiolate |
| InChIKey | LTONLRVDOIFITJ-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C.C(F)(F)(F)[S-] |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Tetramethylammonium (trifluoromethyl)sulfanide, Tetramethylammonium trifluoromethanethiolate, tetramethylazanium trifluoromethanethiolate, tetramethylazanium;trifluoromethanethiolate, (trifluoromethyl)sulfanide; tetramethylazanium, Tetramethylammoniumtrifluoromethanethiolate, tetramethylammonium;trifluoromethanethiolate, tetramethylammonium trifluorometh-anethiolate