cas: 355408-55-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Thiophene-2-boronic acid, neopentyl glycol ester, 98%, 98% (CAS 355408-55-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114M9Z-250mg |
| cas | 355408-55-8 |
| opakowanie | 250mg |
| dostępność | 50g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 74,00 Pln | |
| Chemat | 1g | 98,00 Pln | |
| Chemat | 5g | 189,20 Pln | |
| Chemat | 25g | 635,60 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
5,5-dimethyl-2-thiophen-2-yl-1,3,2-dioxaborinane (CAS 355408-55-8) to związek chemiczny o wzorze sumarycznym C9H13BO2S i masie molowej 196.08 g/mol. Nazwa systematyczna IUPAC: 5,5-dimethyl-2-thiophen-2-yl-1,3,2-dioxaborinane. InChIKey: OQCFQKMFRXSPPP-UHFFFAOYSA-N.
| Wzór sumaryczny | C9H13BO2S |
|---|---|
| Masa molowa | 196.08 g/mol |
| Nazwa IUPAC | 5,5-dimethyl-2-thiophen-2-yl-1,3,2-dioxaborinane |
| InChIKey | OQCFQKMFRXSPPP-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=CS2 |
Dane obliczone przez PubChem (NCBI)