cas: 13640-78-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Trans-1,2-di(2-thienyl)ethylene, 98% (CAS 13640-78-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 100mg, 250mg, 1g. Oferty producentów: AmBeed, Fluorochem, Chemat.
| producent | AmBeed |
|---|---|
| nr katalogowy | A695742-5g |
| cas | 13640-78-3 |
| opakowanie | 5g |
| dostępność | Synthetic Items: 0g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| AmBeed | 5g | 6762,28 Pln | |
| Fluorochem | 100mg | 216,61 Pln | |
| Fluorochem | 250mg | 331,15 Pln | |
| Fluorochem | 1g | 601,89 Pln | |
| Chemat | 100mg | 141,20 Pln | |
| Chemat | 250mg | 208,40 Pln | |
| Chemat | 1g | 362,00 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | Do potwierdzenia przez Chemat |
2-[(E)-2-thiophen-2-ylethenyl]thiophene (CAS 13640-78-3) to związek chemiczny o wzorze sumarycznym C10H8S2 i masie molowej 192.3 g/mol. Nazwa systematyczna IUPAC: 2-[(E)-2-thiophen-2-ylethenyl]thiophene. InChIKey: AYBFWHPZXYPJFW-AATRIKPKSA-N.
| Wzór sumaryczny | C10H8S2 |
|---|---|
| Masa molowa | 192.3 g/mol |
| Nazwa IUPAC | 2-[(E)-2-thiophen-2-ylethenyl]thiophene |
| InChIKey | AYBFWHPZXYPJFW-AATRIKPKSA-N |
| SMILES | C1=CSC(=C1)/C=C/C2=CC=CS2 |
Dane obliczone przez PubChem (NCBI)