Trans-2-Phenylvinylboronic acid pinacol ester, 96%
cas: 83947-56-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Trans-2-Phenylvinylboronic acid pinacol ester, 96% (CAS 83947-56-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A746288-100mg |
| cas | 83947-56-2 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 125,62 Pln | |
| Ambeed | 250mg | 142,31 Pln | |
| Ambeed | 1g | 231,31 Pln | |
| Ambeed | 5g | 420,44 Pln | |
| Ambeed | 10g | 748,62 Pln | |
| Ambeed | 25g | 1499,56 Pln | |
| Ambeed | 100g | 5777,12 Pln |
właściwości
| czystość | 96% |
|---|---|
| czas dostawy | 1-2 tygodnie |
4,4,5,5-tetramethyl-2-[(E)-2-phenylethenyl]-1,3,2-dioxaborolane (CAS 83947-56-2) to związek chemiczny o wzorze sumarycznym C14H19BO2 i masie molowej 230.11 g/mol. Nazwa systematyczna IUPAC: 4,4,5,5-tetramethyl-2-[(E)-2-phenylethenyl]-1,3,2-dioxaborolane. InChIKey: ARAINKADEARZLZ-ZHACJKMWSA-N.
| Wzór sumaryczny | C14H19BO2 |
|---|---|
| Masa molowa | 230.11 g/mol |
| Nazwa IUPAC | 4,4,5,5-tetramethyl-2-[(E)-2-phenylethenyl]-1,3,2-dioxaborolane |
| InChIKey | ARAINKADEARZLZ-ZHACJKMWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC=CC=C2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4,4,5,5-tetramethyl-2-[(E)-2-phenylethenyl]-1,3,2-dioxaborolane, trans-b-Styrylboronic acid pinacol ester, (E)-4,4,5,5-Tetramethyl-2-styryl-1,3,2-dioxaborolane, 4,4,5,5-Tetramethyl-2-styryl-1,3,2-dioxaborolane, e-phenylethenylboronic acid, pinacol ester, trans-2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)styrene, trans-2-Phenylvinylboronic acid pinacol ester, 4,4,5,5-tetramethyl-2-[(1E)-2-phenylethenyl]-1,3,2-dioxaborolane, E-Phenylethenylboronic acid,pinacol ester, styrylboronic acid pinacol ester