Trimetazidine (dihydrochloride), 99.91%
cas: 13171-25-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Trimetazidine (dihydrochloride), 99.91% (CAS 13171-25-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 500 mg, 25 mg, 5 mg, 10mM/1mL, 10 mg, 1 g, 100 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-B0968-500 mg |
| cas | 13171-25-0 |
| opakowanie | 500 mg |
| dostępność | Get quote |
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 500 mg | 1225,27 Pln | |
| MedChemExpress | 25 mg | 333,62 Pln | |
| MedChemExpress | 5 mg | 240,74 Pln | |
| MedChemExpress | 10mM/1mL | 277,90 Pln | |
| MedChemExpress | 10 mg | 263,96 Pln | |
| MedChemExpress | 1 g | 1680,38 Pln | |
| MedChemExpress | 100 mg | 607,62 Pln | |
| MedChemExpress | 50 mg | 407,93 Pln |
właściwości
| czas dostawy | ponad 3 tygodnie |
|---|---|
| czystość | 99.91% |
1-[(2,3,4-trimethoxyphenyl)methyl]piperazine;dihydrochloride (CAS 13171-25-0) to związek chemiczny o wzorze sumarycznym C14H24Cl2N2O3 i masie molowej 339.3 g/mol. Nazwa systematyczna IUPAC: 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine;dihydrochloride. InChIKey: VYFLPFGUVGMBEP-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H24Cl2N2O3 |
|---|---|
| Masa molowa | 339.3 g/mol |
| Nazwa IUPAC | 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine;dihydrochloride |
| InChIKey | VYFLPFGUVGMBEP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CN2CCNCC2)OC)OC.Cl.Cl |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Trimetazidine dihydrochloride, 1-(2,3,4-Trimethoxybenzyl)piperazine dihydrochloride, Trimetazidine hydrochloride, Kyurinett, Trimetazidine HCl, Trimetazidine di-hcl, Trimethazidine dihydrochloride, Dihydrochloride, Trimetazidine, 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine dihydrochloride, Trimetazidine 2HCl