Trimetrexate, 98%
cas: 52128-35-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Trimetrexate, 98% (CAS 52128-35-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5mg, 100mg, 250mg, 10mg, 25mg, 50mg. Oferty producentów: AmBeed, Chemat.
| producent | AmBeed |
|---|---|
| nr katalogowy | A964519-5mg |
| cas | 52128-35-5 |
| opakowanie | 5mg |
| dostępność | Synthetic Items: 0g |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| AmBeed | 5mg | 2726,08 Pln | |
| Ambeed | 100mg | 2773,38 Pln | |
| Ambeed | 250mg | 6528,06 Pln | |
| Chemat | 10mg | 539,60 Pln | |
| Chemat | 25mg | 971,60 Pln | |
| Chemat | 50mg | 1605,20 Pln | |
| Chemat | 100mg | 2834,00 Pln | |
| Chemat | 250mg | 6798,80 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | Do potwierdzenia przez Chemat |
5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine (CAS 52128-35-5) to związek chemiczny o wzorze sumarycznym C19H23N5O3 i masie molowej 369.4 g/mol. Nazwa systematyczna IUPAC: 5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine. InChIKey: NOYPYLRCIDNJJB-UHFFFAOYSA-N.
| Wzór sumaryczny | C19H23N5O3 |
|---|---|
| Masa molowa | 369.4 g/mol |
| Nazwa IUPAC | 5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine |
| InChIKey | NOYPYLRCIDNJJB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C(=NC(=N2)N)N)CNC3=CC(=C(C(=C3)OC)OC)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
trimetrexate, Trimetrexato, Trimetrexatum, 5-methyl-6-{[(3,4,5-trimethoxyphenyl)amino]methyl}quinazoline-2,4-diamine, 2,4-Diamino-5-methyl-6-((3,4,5-trimethoxyanilino)methyl)quinazoline, 5-Methyl-6-(((3,4,5-trimethoxyphenyl)amino)methyl)-2,4-quinazolinediamine, 5-methyl-6-(((3,4,5-trimethoxyphenyl)amino)methyl)quinazoline-2,4-diamine, 2,4-Quinazolinediamine, 5-methyl-6-(((3,4,5-trimethoxyphenyl)amino)methyl)-, 5-methyl-6-[[(3,4,5-trimethoxyphenyl)amino]methyl]quinazoline-2,4-diamine, 2,4-diamino-5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline