Tris(2,2,2-trifluoroethyl) borate
cas: 659-18-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Tris(2,2,2-trifluoroethyl) borate (CAS 659-18-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Oferty producentów: TargetMol.
| producent | TargetMol |
|---|---|
| nr katalogowy | T2186-5mg |
| cas | 659-18-7 |
| opakowanie | 5mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 5mg | 379,44 Pln | |
| TargetMol | 10mg | 425,84 Pln | |
| TargetMol | 25mg | 611,98 Pln | |
| TargetMol | 50mg | 930,61 Pln | |
| TargetMol | 100mg | 1442,10 Pln | |
| TargetMol | 200mg | 2079,36 Pln |
właściwości
| czystość | No data |
|---|---|
| czas dostawy | ok. 15 dni |
Tris(2,2,2-trifluoroethyl) borate (CAS 659-18-7) to związek chemiczny o wzorze sumarycznym C6H6BF9O3 i masie molowej 307.91 g/mol. Nazwa systematyczna IUPAC: tris(2,2,2-trifluoroethyl) borate. InChIKey: DIEXQJFSUBBIRP-UHFFFAOYSA-N.
| Wzór sumaryczny | C6H6BF9O3 |
|---|---|
| Masa molowa | 307.91 g/mol |
| Nazwa IUPAC | tris(2,2,2-trifluoroethyl) borate |
| InChIKey | DIEXQJFSUBBIRP-UHFFFAOYSA-N |
| SMILES | B(OCC(F)(F)F)(OCC(F)(F)F)OCC(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
tris(2,2,2-trifluoroethyl) borate, Tris(2,2,2-trifluoroethoxy)boron, Tris(2,2,2-trifluoroethyl)Borate, Boric Acid Tris(2,2,2-trifluoroethyl) Ester, Ethanol, 2,2,2-trifluoro-, triester with boric acid (H3BO3), Tris(2,2,2-trifluoroethoxy)borane, Sheppard Reagent, TTFEB, Sheppard Amidation Reagent, orb1224315