cas: 1142214-62-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Tris(2,2 (CAS 1142214-62-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5mg, 10mg, 25mg, 2mg, 50mg, 100mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11HCUT-5mg |
| cas | 1142214-62-7 |
| opakowanie | 5mg |
| dostępność | 0.1g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 5mg | 1763,60 Pln | |
| Chemat | 10mg | 2795,60 Pln | |
| Chemat | 25mg | 4374,80 Pln | |
| Chemat | 2mg | 1139,60 Pln | |
| Chemat | 50mg | 5882,00 Pln | |
| Chemat | 100mg | 7840,40 Pln |
| czas dostawy | 3 tygodnie |
|---|
(3S)-3-cyclopropyl-3-[3-[[3-(5,5-dimethylcyclopenten-1-yl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]propanoic acid (CAS 1142214-62-7) to związek chemiczny o wzorze sumarycznym C33H35FO4 i masie molowej 514.6 g/mol. Nazwa systematyczna IUPAC: (3S)-3-cyclopropyl-3-[3-[[3-(5,5-dimethylcyclopenten-1-yl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]propanoic acid. InChIKey: CHEANNSDVJOIBS-MHZLTWQESA-N.
| Wzór sumaryczny | C33H35FO4 |
|---|---|
| Masa molowa | 514.6 g/mol |
| Nazwa IUPAC | (3S)-3-cyclopropyl-3-[3-[[3-(5,5-dimethylcyclopenten-1-yl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]propanoic acid |
| InChIKey | CHEANNSDVJOIBS-MHZLTWQESA-N |
| SMILES | CC1(CCC=C1C2=C(C=CC(=C2)COC3=CC=CC(=C3)[C@@H](CC(=O)O)C4CC4)C5=C(C=CC(=C5)OC)F)C |
Dane obliczone przez PubChem (NCBI)