cas: 3039-71-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
U18666A, 99.79% (CAS 3039-71-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 10mM/1mL, 50 mg, 25 mg, 10 mg, 5 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-107433-100 mg |
| cas | 3039-71-2 |
| opakowanie | 100 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 2757,79 Pln | |
| MedChemExpress | 10mM/1mL | 542,60 Pln | |
| MedChemExpress | 50 mg | 1875,43 Pln | |
| MedChemExpress | 25 mg | 1290,29 Pln | |
| MedChemExpress | 10 mg | 742,30 Pln | |
| MedChemExpress | 5 mg | 505,45 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.79% |
(3S,8R,9S,10R,13S,14S)-3-[2-(diethylamino)ethoxy]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one;hydrochloride (CAS 3039-71-2) to związek chemiczny o wzorze sumarycznym C25H42ClNO2 i masie molowej 424.1 g/mol. Nazwa systematyczna IUPAC: (3S,8R,9S,10R,13S,14S)-3-[2-(diethylamino)ethoxy]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one;hydrochloride. InChIKey: GZFYZYBWLCYBMI-MYZJJQSMSA-N.
| Wzór sumaryczny | C25H42ClNO2 |
|---|---|
| Masa molowa | 424.1 g/mol |
| Nazwa IUPAC | (3S,8R,9S,10R,13S,14S)-3-[2-(diethylamino)ethoxy]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one;hydrochloride |
| InChIKey | GZFYZYBWLCYBMI-MYZJJQSMSA-N |
| SMILES | CCN(CC)CCO[C@H]1CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CC=C2C1)CCC4=O)C)C.Cl |
Dane obliczone przez PubChem (NCBI)