cas: 159811-51-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Ulipristal, 98.0% (CAS 159811-51-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 5 mg, 10 mg, 10mM/1mL, 25 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-14959-100 mg |
| cas | 159811-51-5 |
| opakowanie | 100 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 2711,35 Pln | |
| MedChemExpress | 5 mg | 407,93 Pln | |
| MedChemExpress | 10 mg | 598,33 Pln | |
| MedChemExpress | 10mM/1mL | 435,79 Pln | |
| MedChemExpress | 25 mg | 1081,31 Pln | |
| MedChemExpress | 50 mg | 1703,60 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.0% |
(8S,11R,13S,14S,17R)-17-acetyl-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (CAS 159811-51-5) to związek chemiczny o wzorze sumarycznym C28H35NO3 i masie molowej 433.6 g/mol. Nazwa systematyczna IUPAC: (8S,11R,13S,14S,17R)-17-acetyl-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one. InChIKey: HKDLNTKNLJPAIY-WKWWZUSTSA-N.
| Wzór sumaryczny | C28H35NO3 |
|---|---|
| Masa molowa | 433.6 g/mol |
| Nazwa IUPAC | (8S,11R,13S,14S,17R)-17-acetyl-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| InChIKey | HKDLNTKNLJPAIY-WKWWZUSTSA-N |
| SMILES | CC(=O)[C@]1(CC[C@@H]2[C@@]1(C[C@@H](C3=C4CCC(=O)C=C4CC[C@@H]23)C5=CC=C(C=C5)N(C)C)C)O |
Dane obliczone przez PubChem (NCBI)